About 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine
2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine (PubChem CID 158688817) has the molecular formula C12H17BrN6
and a molecular weight of 325.21 g/mol. Its IUPAC name is 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine |
| PubChem CID | 158688817 |
| Molecular Formula | C12H17BrN6 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine |
| SMILES | Cc1cncc(Br)n1.Cc1cncc(NCCN)n1 |
| InChI | InChI=1S/C7H12N4.C5H5BrN2/c1-6-4-9-5-7(11-6)10-3-2-8;1-4-2-7-3-5(6)8-4/h4-5H,2-3,8H2,1H3,(H,10,11);2-3H,1H3 |
| InChIKey | IGBSWRUMAMBOBP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine?
The IUPAC name of 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine (CID 158688817) is 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine.
What is the SMILES notation for 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine?
The canonical SMILES for 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine is Cc1cncc(Br)n1.Cc1cncc(NCCN)n1.
What is the InChIKey of 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine?
The InChIKey is IGBSWRUMAMBOBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4.C5H5BrN2/c1-6-4-9-5-7(11-6)10-3-2-8;1-4-2-7-3-5(6)8-4/h4-5H,2-3,8H2,1H3,(H,10,11);2-3H,1H3.
What are the key properties of 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine?
2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine has a molecular weight of 325.21 g/mol, XLogP of 1.70, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-methylpyrazine;N'-(6-methylpyrazin-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 158688817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).