C19H22N2O5S — CID 15869001
[(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate (PubChem CID 15869001) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is [(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate.
| Compound Name | [(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
|---|---|
| PubChem CID | 15869001 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | [(Z)-[cyano-(4-methoxyphenyl)methylidene]amino] 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-sulfonate |
| SMILES | COc1ccc(/C(C#N)=N/OS(=O)(=O)C2C(=O)C3(C)CCC2C3(C)C)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-18(2)14-9-10-19(18,3)17(22)16(14)27(23,24)26-21-15(11-20)12-5-7-13(25-4)8-6-12/h5-8,14,16H,9-10H2,1-4H3/b21-15+ |
| InChIKey | BHBCAPGXJMKJQP-RCCKNPSSSA-N |
| XLogP | 2.66 |
| TPSA | 105.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|