About 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform
2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform (PubChem CID 158690519) has the molecular formula C17H12Cl2F3N5O
and a molecular weight of 430.22 g/mol. Its IUPAC name is 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform.
Molecular Properties
| Compound Name | 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform |
| PubChem CID | 158690519 |
| Molecular Formula | C17H12Cl2F3N5O |
| Molecular Weight | 430.22 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform |
| SMILES | Clc1ccc(CCc2cc3oc(-c4nn[nH]n4)cc3cc2Cl)cn1.FC(F)F |
| InChI | InChI=1S/C16H11Cl2N5O.CHF3/c17-12-5-11-7-14(16-20-22-23-21-16)24-13(11)6-10(12)3-1-9-2-4-15(18)19-8-9;2-1(3)4/h2,4-8H,1,3H2,(H,20,21,22,23);1H |
| InChIKey | IGHCQNHEYFSCPW-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.22 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform?
The IUPAC name of 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform (CID 158690519) is 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform.
What is the SMILES notation for 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform?
The canonical SMILES for 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform is Clc1ccc(CCc2cc3oc(-c4nn[nH]n4)cc3cc2Cl)cn1.FC(F)F.
What is the InChIKey of 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform?
The InChIKey is IGHCQNHEYFSCPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2N5O.CHF3/c17-12-5-11-7-14(16-20-22-23-21-16)24-13(11)6-10(12)3-1-9-2-4-15(18)19-8-9;2-1(3)4/h2,4-8H,1,3H2,(H,20,21,22,23);1H.
What are the key properties of 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform?
2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform has a molecular weight of 430.22 g/mol, XLogP of 5.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[2-[5-chloro-2-(2H-tetrazol-5-yl)-1-benzofuran-6-yl]ethyl]pyridine;fluoroform is sourced from PubChem (CID 158690519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).