C11H20OS — CID 158690827
(2E,6E)-3,7-dimethyl-8-methylsulfanylocta-2,6-dien-1-ol (PubChem CID 158690827) has the molecular formula C11H20OS and a molecular weight of 200.35 g/mol. Its IUPAC name is (2E,6E)-3,7-dimethyl-8-methylsulfanylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-3,7-dimethyl-8-methylsulfanylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 158690827 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2E,6E)-3,7-dimethyl-8-methylsulfanylocta-2,6-dien-1-ol |
| SMILES | CSC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C11H20OS/c1-10(7-8-12)5-4-6-11(2)9-13-3/h6-7,12H,4-5,8-9H2,1-3H3/b10-7+,11-6+ |
| InChIKey | IGICUIZSITWZSZ-NXAIOARDSA-N |
| XLogP | 3.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|