C22H28BBrF4N2O2 — CID 158691662
5-bromo-2,3-difluoropyridine;2,3-difluoro-5-propan-2-ylpyridine;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane (PubChem CID 158691662) has the molecular formula C22H28BBrF4N2O2 and a molecular weight of 519.19 g/mol. Its IUPAC name is 5-bromo-2,3-difluoropyridine;2,3-difluoro-5-propan-2-ylpyridine;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane.
| Compound Name | 5-bromo-2,3-difluoropyridine;2,3-difluoro-5-propan-2-ylpyridine;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158691662 |
| Molecular Formula | C22H28BBrF4N2O2 |
| Molecular Weight | 519.19 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 5-bromo-2,3-difluoropyridine;2,3-difluoro-5-propan-2-ylpyridine;4,4,5,5-tetramethyl-2-prop-1-en-2-yl-1,3,2-dioxaborolane |
| SMILES | C=C(C)B1OC(C)(C)C(C)(C)O1.CC(C)c1cnc(F)c(F)c1.Fc1cc(Br)cnc1F |
| InChI | InChI=1S/C9H17BO2.C8H9F2N.C5H2BrF2N/c1-7(2)10-11-8(3,4)9(5,6)12-10;1-5(2)6-3-7(9)8(10)11-4-6;6-3-1-4(7)5(8)9-2-3/h1H2,2-6H3;3-5H,1-2H3;1-2H |
| InChIKey | IGKQURMQODGIGF-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.19 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|