About 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole
3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole (PubChem CID 158691800) has the molecular formula C18H11BrN4
and a molecular weight of 363.22 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole.
Molecular Properties
| Compound Name | 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole |
| PubChem CID | 158691800 |
| Molecular Formula | C18H11BrN4 |
| Molecular Weight | 363.22 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(Br)c2c1.[C-]#[N+]c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C9H5BrN2.C9H6N2/c1-11-6-2-3-9-7(4-6)8(10)5-12-9;1-10-8-2-3-9-7(6-8)4-5-11-9/h2-5,12H;2-6,11H |
| InChIKey | IGLCYDKNDYILSX-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 40.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.22 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole?
The IUPAC name of 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole (CID 158691800) is 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole.
What is the SMILES notation for 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole?
The canonical SMILES for 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole is [C-]#[N+]c1ccc2[nH]cc(Br)c2c1.[C-]#[N+]c1ccc2[nH]ccc2c1.
What is the InChIKey of 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole?
The InChIKey is IGLCYDKNDYILSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrN2.C9H6N2/c1-11-6-2-3-9-7(4-6)8(10)5-12-9;1-10-8-2-3-9-7(6-8)4-5-11-9/h2-5,12H;2-6,11H.
What are the key properties of 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole?
3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole has a molecular weight of 363.22 g/mol, XLogP of 6.20, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-isocyano-1H-indole;5-isocyano-1H-indole is sourced from PubChem (CID 158691800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).