C18H23N3O2 — CID 158692295
4-(cyclopentylamino)-3-(2-hydroxybenzenecarboximidoyl)-1H-pyridin-2-one;methane (PubChem CID 158692295) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 4-(cyclopentylamino)-3-(2-hydroxybenzenecarboximidoyl)-1H-pyridin-2-one;methane.
| Compound Name | 4-(cyclopentylamino)-3-(2-hydroxybenzenecarboximidoyl)-1H-pyridin-2-one;methane |
|---|---|
| PubChem CID | 158692295 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-(cyclopentylamino)-3-(2-hydroxybenzenecarboximidoyl)-1H-pyridin-2-one;methane |
| SMILES | C.[H]/N=C(\c1ccccc1O)c1c(NC2CCCC2)cc[nH]c1=O |
| InChI | InChI=1S/C17H19N3O2.CH4/c18-16(12-7-3-4-8-14(12)21)15-13(9-10-19-17(15)22)20-11-5-1-2-6-11;/h3-4,7-11,18,21H,1-2,5-6H2,(H2,19,20,22);1H4/b18-16+; |
| InChIKey | IGMSODXWGWYAIC-HYNBPGMHSA-N |
| XLogP | 3.49 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|