C44H32O8 — CID 15869295
11,22-bis(4-tert-butylphenoxy)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone (PubChem CID 15869295) has the molecular formula C44H32O8 and a molecular weight of 688.73 g/mol. Its IUPAC name is 11,22-bis(4-tert-butylphenoxy)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone.
| Compound Name | 11,22-bis(4-tert-butylphenoxy)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 15869295 |
| Molecular Formula | C44H32O8 |
| Molecular Weight | 688.73 g/mol |
| Exact Mass | 688.21 |
| IUPAC Name | 11,22-bis(4-tert-butylphenoxy)-7,18-dioxaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2,4,9,11,13(23),14,16(24),20,25-decaene-6,8,17,19-tetrone |
| SMILES | CC(C)(C)c1ccc(Oc2cc3c4c(ccc5c6c(Oc7ccc(C(C)(C)C)cc7)cc7c8c(ccc(c2c45)c86)C(=O)OC7=O)C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C44H32O8/c1-43(2,3)21-7-11-23(12-8-21)49-31-19-29-33-27(39(45)51-41(29)47)18-16-26-36-32(50-24-13-9-22(10-14-24)44(4,5)6)20-30-34-28(40(46)52-42(30)48)17-15-25(38(34)36)35(31)37(26)33/h7-20H,1-6H3 |
| InChIKey | ABIUFOPOQSYRPF-UHFFFAOYSA-N |
| XLogP | 10.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.73 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|