About 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane
2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane (PubChem CID 158693133) has the molecular formula C15H18F6O
and a molecular weight of 328.30 g/mol. Its IUPAC name is 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane.
Molecular Properties
| Compound Name | 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane |
| PubChem CID | 158693133 |
| Molecular Formula | C15H18F6O |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane |
| SMILES | C1CCOC1.CC(C)(C)c1c(F)cc(F)c(C(F)(F)F)c1F |
| InChI | InChI=1S/C11H10F6.C4H8O/c1-10(2,3)7-5(12)4-6(13)8(9(7)14)11(15,16)17;1-2-4-5-3-1/h4H,1-3H3;1-4H2 |
| InChIKey | IGPIUSFKOFUURC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane?
The IUPAC name of 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane (CID 158693133) is 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane.
What is the SMILES notation for 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane?
The canonical SMILES for 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane is C1CCOC1.CC(C)(C)c1c(F)cc(F)c(C(F)(F)F)c1F.
What is the InChIKey of 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane?
The InChIKey is IGPIUSFKOFUURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F6.C4H8O/c1-10(2,3)7-5(12)4-6(13)8(9(7)14)11(15,16)17;1-2-4-5-3-1/h4H,1-3H3;1-4H2.
What are the key properties of 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane?
2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane has a molecular weight of 328.30 g/mol, XLogP of 5.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,3,5-trifluoro-4-(trifluoromethyl)benzene;oxolane is sourced from PubChem (CID 158693133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).