C21H18FN5O7S2 — CID 15869336
4-[[4-[benzyl(methyl)amino]-6-fluoro-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-2,7-disulfonic acid (PubChem CID 15869336) has the molecular formula C21H18FN5O7S2 and a molecular weight of 535.54 g/mol. Its IUPAC name is 4-[[4-[benzyl(methyl)amino]-6-fluoro-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-2,7-disulfonic acid.
| Compound Name | 4-[[4-[benzyl(methyl)amino]-6-fluoro-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-2,7-disulfonic acid |
|---|---|
| PubChem CID | 15869336 |
| Molecular Formula | C21H18FN5O7S2 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.06 |
| IUPAC Name | 4-[[4-[benzyl(methyl)amino]-6-fluoro-1,3,5-triazin-2-yl]amino]-5-hydroxynaphthalene-2,7-disulfonic acid |
| SMILES | CN(Cc1ccccc1)c1nc(F)nc(Nc2cc(S(=O)(=O)O)cc3cc(S(=O)(=O)O)cc(O)c23)n1 |
| InChI | InChI=1S/C21H18FN5O7S2/c1-27(11-12-5-3-2-4-6-12)21-25-19(22)24-20(26-21)23-16-9-14(35(29,30)31)7-13-8-15(36(32,33)34)10-17(28)18(13)16/h2-10,28H,11H2,1H3,(H,29,30,31)(H,32,33,34)(H,23,24,25,26) |
| InChIKey | RDTZQNMWCLWRHL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|