About 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane
1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane (PubChem CID 158693579) has the molecular formula C13H22F2N4O
and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane.
Molecular Properties
| Compound Name | 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane |
| PubChem CID | 158693579 |
| Molecular Formula | C13H22F2N4O |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane |
| SMILES | C.Cc1c(N)cnn1C1CCN(C2COC2)CC1(F)F |
| InChI | InChI=1S/C12H18F2N4O.CH4/c1-8-10(15)4-16-18(8)11-2-3-17(7-12(11,13)14)9-5-19-6-9;/h4,9,11H,2-3,5-7,15H2,1H3;1H4 |
| InChIKey | IGQQITFUFJROOD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane?
The IUPAC name of 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane (CID 158693579) is 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane.
What is the SMILES notation for 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane?
The canonical SMILES for 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane is C.Cc1c(N)cnn1C1CCN(C2COC2)CC1(F)F.
What is the InChIKey of 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane?
The InChIKey is IGQQITFUFJROOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N4O.CH4/c1-8-10(15)4-16-18(8)11-2-3-17(7-12(11,13)14)9-5-19-6-9;/h4,9,11H,2-3,5-7,15H2,1H3;1H4.
What are the key properties of 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane?
1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane has a molecular weight of 288.34 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,3-difluoro-1-(oxetan-3-yl)piperidin-4-yl]-5-methylpyrazol-4-amine;methane is sourced from PubChem (CID 158693579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).