C22H22ClN3 — CID 158694209
2-[4-[(6-chloro-3-propyl-1,5-naphthyridin-4-yl)methyl]phenyl]-2-methylpropanenitrile (PubChem CID 158694209) has the molecular formula C22H22ClN3 and a molecular weight of 363.89 g/mol. Its IUPAC name is 2-[4-[(6-chloro-3-propyl-1,5-naphthyridin-4-yl)methyl]phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[(6-chloro-3-propyl-1,5-naphthyridin-4-yl)methyl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 158694209 |
| Molecular Formula | C22H22ClN3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-[4-[(6-chloro-3-propyl-1,5-naphthyridin-4-yl)methyl]phenyl]-2-methylpropanenitrile |
| SMILES | CCCc1cnc2ccc(Cl)nc2c1Cc1ccc(C(C)(C)C#N)cc1 |
| InChI | InChI=1S/C22H22ClN3/c1-4-5-16-13-25-19-10-11-20(23)26-21(19)18(16)12-15-6-8-17(9-7-15)22(2,3)14-24/h6-11,13H,4-5,12H2,1-3H3 |
| InChIKey | IGSQSVOUVDIIBY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|