C7H12O2S — CID 15869435
(3aS,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole (PubChem CID 15869435) has the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. Its IUPAC name is (3aS,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole.
| Compound Name | (3aS,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
|---|---|
| PubChem CID | 15869435 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (3aS,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2CSC[C@H]2O1 |
| InChI | InChI=1S/C7H12O2S/c1-7(2)8-5-3-10-4-6(5)9-7/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | ZTNZFIAWRNNHKN-OLQVQODUSA-N |
| XLogP | 1.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |