About 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione
3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione (PubChem CID 158694425) has the molecular formula C10H7BrO6
and a molecular weight of 303.06 g/mol. Its IUPAC name is 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione.
Molecular Properties
| Compound Name | 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione |
| PubChem CID | 158694425 |
| Molecular Formula | C10H7BrO6 |
| Molecular Weight | 303.06 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione |
| SMILES | CC1=C(Br)C(=O)OC1=O.CC1=CC(=O)OC1=O |
| InChI | InChI=1S/C5H3BrO3.C5H4O3/c1-2-3(6)5(8)9-4(2)7;1-3-2-4(6)8-5(3)7/h1H3;2H,1H3 |
| InChIKey | IGTIATLQSPRHCG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.06 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione?
The IUPAC name of 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione (CID 158694425) is 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione.
What is the SMILES notation for 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione?
The canonical SMILES for 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione is CC1=C(Br)C(=O)OC1=O.CC1=CC(=O)OC1=O.
What is the InChIKey of 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione?
The InChIKey is IGTIATLQSPRHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrO3.C5H4O3/c1-2-3(6)5(8)9-4(2)7;1-3-2-4(6)8-5(3)7/h1H3;2H,1H3.
What are the key properties of 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione?
3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione has a molecular weight of 303.06 g/mol, XLogP of 0.75, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-methylfuran-2,5-dione;3-methylfuran-2,5-dione is sourced from PubChem (CID 158694425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).