C24H34N2O2 — CID 158694819
1-(1-cyclohexylpiperidin-4-yl)-3-methyl-3-(2-oxobutyl)indol-2-one (PubChem CID 158694819) has the molecular formula C24H34N2O2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-(1-cyclohexylpiperidin-4-yl)-3-methyl-3-(2-oxobutyl)indol-2-one.
| Compound Name | 1-(1-cyclohexylpiperidin-4-yl)-3-methyl-3-(2-oxobutyl)indol-2-one |
|---|---|
| PubChem CID | 158694819 |
| Molecular Formula | C24H34N2O2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.26 |
| IUPAC Name | 1-(1-cyclohexylpiperidin-4-yl)-3-methyl-3-(2-oxobutyl)indol-2-one |
| SMILES | CCC(=O)CC1(C)C(=O)N(C2CCN(C3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H34N2O2/c1-3-20(27)17-24(2)21-11-7-8-12-22(21)26(23(24)28)19-13-15-25(16-14-19)18-9-5-4-6-10-18/h7-8,11-12,18-19H,3-6,9-10,13-17H2,1-2H3 |
| InChIKey | IGUPAMXYBSQGJE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |