About 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione
2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione (PubChem CID 158695187) has the molecular formula C6H8N2O4S2
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione |
| PubChem CID | 158695187 |
| Molecular Formula | C6H8N2O4S2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1.O=C1CSS(=O)N1 |
| InChI | InChI=1S/C4H5NO2.C2H3NO2S2/c6-3-1-2-4(7)5-3;4-2-1-6-7(5)3-2/h1-2H2,(H,5,6,7);1H2,(H,3,4) |
| InChIKey | IGVRTNYXSZKERJ-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione?
The IUPAC name of 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione (CID 158695187) is 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione.
What is the SMILES notation for 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione?
The canonical SMILES for 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione is O=C1CCC(=O)N1.O=C1CSS(=O)N1.
What is the InChIKey of 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione?
The InChIKey is IGVRTNYXSZKERJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H3NO2S2/c6-3-1-2-4(7)5-3;4-2-1-6-7(5)3-2/h1-2H2,(H,5,6,7);1H2,(H,3,4).
What are the key properties of 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione?
2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione has a molecular weight of 236.27 g/mol, XLogP of -1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxodithiazolidin-4-one;pyrrolidine-2,5-dione is sourced from PubChem (CID 158695187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).