About methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate
methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate (PubChem CID 158695329) has the molecular formula C18H17BrCl2O4
and a molecular weight of 448.14 g/mol. Its IUPAC name is methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate.
Molecular Properties
| Compound Name | methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate |
| PubChem CID | 158695329 |
| Molecular Formula | C18H17BrCl2O4 |
| Molecular Weight | 448.14 g/mol |
| Exact Mass | 445.97 |
| IUPAC Name | methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate |
| SMILES | CCc1ccc(Cl)cc1C(=O)OC.COC(=O)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C10H11ClO2.C8H6BrClO2/c1-3-7-4-5-8(11)6-9(7)10(12)13-2;1-12-8(11)6-4-5(10)2-3-7(6)9/h4-6H,3H2,1-2H3;2-4H,1H3 |
| InChIKey | IGWDDZQFBRRMNH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.14 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate?
The IUPAC name of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate (CID 158695329) is methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate.
What is the SMILES notation for methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate?
The canonical SMILES for methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate is CCc1ccc(Cl)cc1C(=O)OC.COC(=O)c1cc(Cl)ccc1Br.
What is the InChIKey of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate?
The InChIKey is IGWDDZQFBRRMNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2.C8H6BrClO2/c1-3-7-4-5-8(11)6-9(7)10(12)13-2;1-12-8(11)6-4-5(10)2-3-7(6)9/h4-6H,3H2,1-2H3;2-4H,1H3.
What are the key properties of methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate?
methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate has a molecular weight of 448.14 g/mol, XLogP of 5.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-5-chlorobenzoate;methyl 5-chloro-2-ethylbenzoate is sourced from PubChem (CID 158695329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).