C18H21N4O2+ — CID 158695674
1-ethyl-3,5-bis(4-methoxyphenyl)-1,2,4-triazol-4-ium-4-amine (PubChem CID 158695674) has the molecular formula C18H21N4O2+ and a molecular weight of 325.39 g/mol. Its IUPAC name is 1-ethyl-3,5-bis(4-methoxyphenyl)-1,2,4-triazol-4-ium-4-amine.
| Compound Name | 1-ethyl-3,5-bis(4-methoxyphenyl)-1,2,4-triazol-4-ium-4-amine |
|---|---|
| PubChem CID | 158695674 |
| Molecular Formula | C18H21N4O2+ |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1-ethyl-3,5-bis(4-methoxyphenyl)-1,2,4-triazol-4-ium-4-amine |
| SMILES | CCn1nc(-c2ccc(OC)cc2)[n+](N)c1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H21N4O2/c1-4-21-18(14-7-11-16(24-3)12-8-14)22(19)17(20-21)13-5-9-15(23-2)10-6-13/h5-12H,4,19H2,1-3H3/q+1 |
| InChIKey | YDWBORMEVMPISL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 66.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|