C60H73N5O+4 — CID 158696886
(E)-1-(4-methylphenyl)-3-pyridin-4-ylprop-2-en-1-one;1,2,4-tris(1-hexylpyridin-1-ium-4-yl)-6-(4-methylphenyl)pyridin-1-ium (PubChem CID 158696886) has the molecular formula C60H73N5O+4 and a molecular weight of 880.28 g/mol. Its IUPAC name is (E)-1-(4-methylphenyl)-3-pyridin-4-ylprop-2-en-1-one;1,2,4-tris(1-hexylpyridin-1-ium-4-yl)-6-(4-methylphenyl)pyridin-1-ium.
| Compound Name | (E)-1-(4-methylphenyl)-3-pyridin-4-ylprop-2-en-1-one;1,2,4-tris(1-hexylpyridin-1-ium-4-yl)-6-(4-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 158696886 |
| Molecular Formula | C60H73N5O+4 |
| Molecular Weight | 880.28 g/mol |
| Exact Mass | 879.58 |
| IUPAC Name | (E)-1-(4-methylphenyl)-3-pyridin-4-ylprop-2-en-1-one;1,2,4-tris(1-hexylpyridin-1-ium-4-yl)-6-(4-methylphenyl)pyridin-1-ium |
| SMILES | CCCCCC[n+]1ccc(-c2cc(-c3ccc(C)cc3)[n+](-c3cc[n+](CCCCCC)cc3)c(-c3cc[n+](CCCCCC)cc3)c2)cc1.Cc1ccc(C(=O)/C=C/c2ccncc2)cc1 |
| InChI | InChI=1S/C45H60N4.C15H13NO/c1-5-8-11-14-27-46-30-21-39(22-31-46)42-36-44(40-19-17-38(4)18-20-40)49(43-25-34-48(35-26-43)29-16-13-10-7-3)45(37-42)41-23-32-47(33-24-41)28-15-12-9-6-2;1-12-2-5-14(6-3-12)15(17)7-4-13-8-10-16-11-9-13/h17-26,30-37H,5-16,27-29H2,1-4H3;2-11H,1H3/q+4;/b;7-4+ |
| InChIKey | RQVCDYHHNXRGJR-DNLQIICGSA-N |
| XLogP | 13.16 |
| TPSA | 45.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.28 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|