C20H18BrF3N2O — CID 158697753
4-[[4-[(5-bromo-3-pyridinyl)oxy]cyclohexyl]methyl]-2-(trifluoromethyl)benzonitrile (PubChem CID 158697753) has the molecular formula C20H18BrF3N2O and a molecular weight of 439.28 g/mol. Its IUPAC name is 4-[[4-[(5-bromo-3-pyridinyl)oxy]cyclohexyl]methyl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[4-[(5-bromo-3-pyridinyl)oxy]cyclohexyl]methyl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 158697753 |
| Molecular Formula | C20H18BrF3N2O |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 4-[[4-[(5-bromo-3-pyridinyl)oxy]cyclohexyl]methyl]-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(CC2CCC(Oc3cncc(Br)c3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H18BrF3N2O/c21-16-9-18(12-26-11-16)27-17-5-2-13(3-6-17)7-14-1-4-15(10-25)19(8-14)20(22,23)24/h1,4,8-9,11-13,17H,2-3,5-7H2 |
| InChIKey | JOZFIPUWRXRVQC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |