About 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one
1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one (PubChem CID 158698125) has the molecular formula C9H4O3SSi
and a molecular weight of 220.28 g/mol. Its IUPAC name is 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one.
Molecular Properties
| Compound Name | 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one |
| PubChem CID | 158698125 |
| Molecular Formula | C9H4O3SSi |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one |
| SMILES | O=C(C#CC#CC#CC#CS)[SiH](O)O |
| InChI | InChI=1S/C9H4O3SSi/c10-9(14(11)12)7-5-3-1-2-4-6-8-13/h11-14H |
| InChIKey | DBPZKJAEIODFRL-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one?
The IUPAC name of 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one (CID 158698125) is 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one.
What is the SMILES notation for 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one?
The canonical SMILES for 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one is O=C(C#CC#CC#CC#CS)[SiH](O)O.
What is the InChIKey of 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one?
The InChIKey is DBPZKJAEIODFRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4O3SSi/c10-9(14(11)12)7-5-3-1-2-4-6-8-13/h11-14H.
What are the key properties of 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one?
1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one has a molecular weight of 220.28 g/mol, XLogP of -1.80, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dihydroxysilyl-9-sulfanylnona-2,4,6,8-tetrayn-1-one is sourced from PubChem (CID 158698125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).