About (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium
(1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium (PubChem CID 158698260) has the molecular formula C9H13OSY-
and a molecular weight of 258.18 g/mol. Its IUPAC name is (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium.
Molecular Properties
| Compound Name | (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium |
| PubChem CID | 158698260 |
| Molecular Formula | C9H13OSY- |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 257.98 |
| IUPAC Name | (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium |
| SMILES | Cc1ccc[c-]c1[C@H](C)O.S.[Y] |
| InChI | InChI=1S/C9H11O.H2S.Y/c1-7-5-3-4-6-9(7)8(2)10;;/h3-5,8,10H,1-2H3;1H2;/q-1;;/t8-;;/m0../s1 |
| InChIKey | ZPJZPKJYDHARTP-JZGIKJSDSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium?
The IUPAC name of (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium (CID 158698260) is (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium.
What is the SMILES notation for (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium?
The canonical SMILES for (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium is Cc1ccc[c-]c1[C@H](C)O.S.[Y].
What is the InChIKey of (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium?
The InChIKey is ZPJZPKJYDHARTP-JZGIKJSDSA-N. The full InChI is InChI=1S/C9H11O.H2S.Y/c1-7-5-3-4-6-9(7)8(2)10;;/h3-5,8,10H,1-2H3;1H2;/q-1;;/t8-;;/m0../s1.
What are the key properties of (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium?
(1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium has a molecular weight of 258.18 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(2-methylbenzene-6-id-1-yl)ethanol;sulfane;yttrium is sourced from PubChem (CID 158698260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).