C27H44N6O6Si — CID 158698305
(1-ethoxycyclopropyl)oxy-trimethylsilane;methyl 7-cyclopropyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate;methyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate (PubChem CID 158698305) has the molecular formula C27H44N6O6Si and a molecular weight of 576.77 g/mol. Its IUPAC name is (1-ethoxycyclopropyl)oxy-trimethylsilane;methyl 7-cyclopropyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate;methyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | (1-ethoxycyclopropyl)oxy-trimethylsilane;methyl 7-cyclopropyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate;methyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 158698305 |
| Molecular Formula | C27H44N6O6Si |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (1-ethoxycyclopropyl)oxy-trimethylsilane;methyl 7-cyclopropyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylate;methyl 5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine-2-carboxylate |
| SMILES | CCOC1(O[Si](C)(C)C)CC1.COC(=O)c1cn2c(n1)CN(C1CC1)CC2.COC(=O)c1cn2c(n1)CNCC2 |
| InChI | InChI=1S/C11H15N3O2.C8H11N3O2.C8H18O2Si/c1-16-11(15)9-6-14-5-4-13(8-2-3-8)7-10(14)12-9;1-13-8(12)6-5-11-3-2-9-4-7(11)10-6;1-5-9-8(6-7-8)10-11(2,3)4/h6,8H,2-5,7H2,1H3;5,9H,2-4H2,1H3;5-7H2,1-4H3 |
| InChIKey | IHFJOFLWICLFDQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 121.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|