About 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole
2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole (PubChem CID 158699619) has the molecular formula C15H12N4O2S
and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole |
| PubChem CID | 158699619 |
| Molecular Formula | C15H12N4O2S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole |
| SMILES | Cc1nccs1.N#Cc1ccc(-n2nccc2C(=O)O)cc1 |
| InChI | InChI=1S/C11H7N3O2.C4H5NS/c12-7-8-1-3-9(4-2-8)14-10(11(15)16)5-6-13-14;1-4-5-2-3-6-4/h1-6H,(H,15,16);2-3H,1H3 |
| InChIKey | IHJJMPZGZARTIZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole?
The IUPAC name of 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole (CID 158699619) is 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole.
What is the SMILES notation for 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole?
The canonical SMILES for 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole is Cc1nccs1.N#Cc1ccc(-n2nccc2C(=O)O)cc1.
What is the InChIKey of 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole?
The InChIKey is IHJJMPZGZARTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2.C4H5NS/c12-7-8-1-3-9(4-2-8)14-10(11(15)16)5-6-13-14;1-4-5-2-3-6-4/h1-6H,(H,15,16);2-3H,1H3.
What are the key properties of 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole?
2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole has a molecular weight of 312.35 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyanophenyl)pyrazole-3-carboxylic acid;2-methyl-1,3-thiazole is sourced from PubChem (CID 158699619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).