About carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone
carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone (PubChem CID 158701287) has the molecular formula C25H18N2O4
and a molecular weight of 410.43 g/mol. Its IUPAC name is carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone.
Molecular Properties
| Compound Name | carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone |
| PubChem CID | 158701287 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ncc(-c2ccccn2)o1)C1Cc2ccc(-c3ccccc3)cc2C1.O=C=O |
| InChI | InChI=1S/C24H18N2O2.CO2/c27-23(24-26-15-22(28-24)21-8-4-5-11-25-21)20-13-18-10-9-17(12-19(18)14-20)16-6-2-1-3-7-16;2-1-3/h1-12,15,20H,13-14H2; |
| InChIKey | IHOQHLXCCYZTEA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The IUPAC name of carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone (CID 158701287) is carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone.
What is the SMILES notation for carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The canonical SMILES for carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone is O=C(c1ncc(-c2ccccn2)o1)C1Cc2ccc(-c3ccccc3)cc2C1.O=C=O.
What is the InChIKey of carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The InChIKey is IHOQHLXCCYZTEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O2.CO2/c27-23(24-26-15-22(28-24)21-8-4-5-11-25-21)20-13-18-10-9-17(12-19(18)14-20)16-6-2-1-3-7-16;2-1-3/h1-12,15,20H,13-14H2;.
What are the key properties of carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone has a molecular weight of 410.43 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;(5-phenyl-2,3-dihydro-1H-inden-2-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone is sourced from PubChem (CID 158701287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).