C54H62N4O2Si2 — CID 158701348
2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5,8-bis(trimethylsilyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 158701348) has the molecular formula C54H62N4O2Si2 and a molecular weight of 855.29 g/mol. Its IUPAC name is 2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5,8-bis(trimethylsilyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5,8-bis(trimethylsilyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 158701348 |
| Molecular Formula | C54H62N4O2Si2 |
| Molecular Weight | 855.29 g/mol |
| Exact Mass | 854.44 |
| IUPAC Name | 2-[2-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5,8-bis(trimethylsilyl)imidazo[4,5-b]quinoxalin-2-ylidene]ethylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=CC=C2C(=O)c3cc4ccccc4cc3C2=O)N(c2c(C(C)C)cccc2C(C)C)c2nc3c([Si](C)(C)C)ccc([Si](C)(C)C)c3nc21 |
| InChI | InChI=1S/C54H62N4O2Si2/c1-31(2)37-21-17-22-38(32(3)4)49(37)57-46(28-25-41-51(59)42-29-35-19-15-16-20-36(35)30-43(42)52(41)60)58(50-39(33(5)6)23-18-24-40(50)34(7)8)54-53(57)55-47-44(61(9,10)11)26-27-45(48(47)56-54)62(12,13)14/h15-34H,1-14H3 |
| InChIKey | IVLPVPDYYNXDNS-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.29 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|