C27H22FNO5S — CID 158702919
3-[4-[4-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-oxobutanoyl]-2-methoxyphenoxy]propanal (PubChem CID 158702919) has the molecular formula C27H22FNO5S and a molecular weight of 491.54 g/mol. Its IUPAC name is 3-[4-[4-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-oxobutanoyl]-2-methoxyphenoxy]propanal.
| Compound Name | 3-[4-[4-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-oxobutanoyl]-2-methoxyphenoxy]propanal |
|---|---|
| PubChem CID | 158702919 |
| Molecular Formula | C27H22FNO5S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 3-[4-[4-[6-(7-fluoro-1-benzothiophen-3-yl)-2-pyridinyl]-4-oxobutanoyl]-2-methoxyphenoxy]propanal |
| SMILES | COc1cc(C(=O)CCC(=O)c2cccc(-c3csc4c(F)cccc34)n2)ccc1OCCC=O |
| InChI | InChI=1S/C27H22FNO5S/c1-33-26-15-17(9-12-25(26)34-14-4-13-30)23(31)10-11-24(32)22-8-3-7-21(29-22)19-16-35-27-18(19)5-2-6-20(27)28/h2-3,5-9,12-13,15-16H,4,10-11,14H2,1H3 |
| InChIKey | POCCNXVEMVPXAQ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|