C14H28F3NO3S — CID 158703052
1-methyl-1-octan-4-ylpyrrolidin-1-ium;trifluoromethanesulfonate (PubChem CID 158703052) has the molecular formula C14H28F3NO3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-methyl-1-octan-4-ylpyrrolidin-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-methyl-1-octan-4-ylpyrrolidin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158703052 |
| Molecular Formula | C14H28F3NO3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-methyl-1-octan-4-ylpyrrolidin-1-ium;trifluoromethanesulfonate |
| SMILES | CCCCC(CCC)[N+]1(C)CCCC1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C13H28N.CHF3O3S/c1-4-6-10-13(9-5-2)14(3)11-7-8-12-14;2-1(3,4)8(5,6)7/h13H,4-12H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | IHUACHJEFZUVEB-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|