About (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide
(3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide (PubChem CID 158703608) has the molecular formula C11H19N5O3S
and a molecular weight of 301.37 g/mol. Its IUPAC name is (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide |
| PubChem CID | 158703608 |
| Molecular Formula | C11H19N5O3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide |
| SMILES | C=CC[C@H]1CN(S(=O)(=O)N(C)C)C[C@@]1(N=[N+]=[N-])C(C)=O |
| InChI | InChI=1S/C11H19N5O3S/c1-5-6-10-7-16(20(18,19)15(3)4)8-11(10,9(2)17)13-14-12/h5,10H,1,6-8H2,2-4H3/t10-,11+/m0/s1 |
| InChIKey | VHELMMUAPKCBFV-WDEREUQCSA-N |
| XLogP | 0.94 |
| TPSA | 106.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide?
The IUPAC name of (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide (CID 158703608) is (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide.
What is the SMILES notation for (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide?
The canonical SMILES for (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide is C=CC[C@H]1CN(S(=O)(=O)N(C)C)C[C@@]1(N=[N+]=[N-])C(C)=O.
What is the InChIKey of (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide?
The InChIKey is VHELMMUAPKCBFV-WDEREUQCSA-N. The full InChI is InChI=1S/C11H19N5O3S/c1-5-6-10-7-16(20(18,19)15(3)4)8-11(10,9(2)17)13-14-12/h5,10H,1,6-8H2,2-4H3/t10-,11+/m0/s1.
What are the key properties of (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide?
(3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide has a molecular weight of 301.37 g/mol, XLogP of 0.94, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3-acetyl-3-azido-N,N-dimethyl-4-prop-2-enylpyrrolidine-1-sulfonamide is sourced from PubChem (CID 158703608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).