About bis(1H-benzo[h]quinolin-10-one);zinc
bis(1H-benzo[h]quinolin-10-one);zinc (PubChem CID 158704847) has the molecular formula C26H18N2O2Zn
and a molecular weight of 455.83 g/mol. Its IUPAC name is bis(1H-benzo[h]quinolin-10-one);zinc.
Molecular Properties
| Compound Name | bis(1H-benzo[h]quinolin-10-one);zinc |
| PubChem CID | 158704847 |
| Molecular Formula | C26H18N2O2Zn |
| Molecular Weight | 455.83 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | bis(1H-benzo[h]quinolin-10-one);zinc |
| SMILES | O=c1cccc2ccc3ccc[nH]c3c12.O=c1cccc2ccc3ccc[nH]c3c12.[Zn] |
| InChI | InChI=1S/2C13H9NO.Zn/c2*15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2*1-8,14H; |
| InChIKey | MSNPTAHZULNQNE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.83 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-benzo[h]quinolin-10-one);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-benzo[h]quinolin-10-one);zinc?
The IUPAC name of bis(1H-benzo[h]quinolin-10-one);zinc (CID 158704847) is bis(1H-benzo[h]quinolin-10-one);zinc.
What is the SMILES notation for bis(1H-benzo[h]quinolin-10-one);zinc?
The canonical SMILES for bis(1H-benzo[h]quinolin-10-one);zinc is O=c1cccc2ccc3ccc[nH]c3c12.O=c1cccc2ccc3ccc[nH]c3c12.[Zn].
What is the InChIKey of bis(1H-benzo[h]quinolin-10-one);zinc?
The InChIKey is MSNPTAHZULNQNE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H9NO.Zn/c2*15-11-5-1-3-9-6-7-10-4-2-8-14-13(10)12(9)11;/h2*1-8,14H;.
What are the key properties of bis(1H-benzo[h]quinolin-10-one);zinc?
bis(1H-benzo[h]quinolin-10-one);zinc has a molecular weight of 455.83 g/mol, XLogP of 5.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-benzo[h]quinolin-10-one);zinc is sourced from PubChem (CID 158704847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).