C17H19FN2O2 — CID 158705281
N-(4-fluorophenyl)acetamide;N-(4-methylphenyl)acetamide (PubChem CID 158705281) has the molecular formula C17H19FN2O2 and a molecular weight of 302.35 g/mol. Its IUPAC name is N-(4-fluorophenyl)acetamide;N-(4-methylphenyl)acetamide.
| Compound Name | N-(4-fluorophenyl)acetamide;N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 158705281 |
| Molecular Formula | C17H19FN2O2 |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-(4-fluorophenyl)acetamide;N-(4-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccc(C)cc1.CC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C9H11NO.C8H8FNO/c1-7-3-5-9(6-4-7)10-8(2)11;1-6(11)10-8-4-2-7(9)3-5-8/h3-6H,1-2H3,(H,10,11);2-5H,1H3,(H,10,11) |
| InChIKey | IIAOOUMGQHTSFR-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |