About 9H-carbazole;bis(thiadiazole)
9H-carbazole;bis(thiadiazole) (PubChem CID 158705635) has the molecular formula C16H13N5S2
and a molecular weight of 339.45 g/mol. Its IUPAC name is 9H-carbazole;bis(thiadiazole).
Molecular Properties
| Compound Name | 9H-carbazole;bis(thiadiazole) |
| PubChem CID | 158705635 |
| Molecular Formula | C16H13N5S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 9H-carbazole;bis(thiadiazole) |
| SMILES | c1ccc2c(c1)[nH]c1ccccc12.c1csnn1.c1csnn1 |
| InChI | InChI=1S/C12H9N.2C2H2N2S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2-5-4-3-1/h1-8,13H;2*1-2H |
| InChIKey | IIBQCNIIPBHHDQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9H-carbazole;bis(thiadiazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;bis(thiadiazole)?
The IUPAC name of 9H-carbazole;bis(thiadiazole) (CID 158705635) is 9H-carbazole;bis(thiadiazole).
What is the SMILES notation for 9H-carbazole;bis(thiadiazole)?
The canonical SMILES for 9H-carbazole;bis(thiadiazole) is c1ccc2c(c1)[nH]c1ccccc12.c1csnn1.c1csnn1.
What is the InChIKey of 9H-carbazole;bis(thiadiazole)?
The InChIKey is IIBQCNIIPBHHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.2C2H2N2S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2*1-2-5-4-3-1/h1-8,13H;2*1-2H.
What are the key properties of 9H-carbazole;bis(thiadiazole)?
9H-carbazole;bis(thiadiazole) has a molecular weight of 339.45 g/mol, XLogP of 4.40, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;bis(thiadiazole) is sourced from PubChem (CID 158705635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).