C21H19ClF4N2O3 — CID 158705744
(4aR,8aS)-6-[3-[2-[2-chloro-6-fluoro-4-(trifluoromethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one (PubChem CID 158705744) has the molecular formula C21H19ClF4N2O3 and a molecular weight of 458.84 g/mol. Its IUPAC name is (4aR,8aS)-6-[3-[2-[2-chloro-6-fluoro-4-(trifluoromethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one.
| Compound Name | (4aR,8aS)-6-[3-[2-[2-chloro-6-fluoro-4-(trifluoromethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
|---|---|
| PubChem CID | 158705744 |
| Molecular Formula | C21H19ClF4N2O3 |
| Molecular Weight | 458.84 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (4aR,8aS)-6-[3-[2-[2-chloro-6-fluoro-4-(trifluoromethyl)phenyl]ethynyl]azetidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrano[3,2-c]pyridin-3-one |
| SMILES | O=C1CO[C@H]2CCN(C(=O)N3CC(C#Cc4c(F)cc(C(F)(F)F)cc4Cl)C3)C[C@H]2C1 |
| InChI | InChI=1S/C21H19ClF4N2O3/c22-17-6-14(21(24,25)26)7-18(23)16(17)2-1-12-8-28(9-12)20(30)27-4-3-19-13(10-27)5-15(29)11-31-19/h6-7,12-13,19H,3-5,8-11H2/t13-,19+/m1/s1 |
| InChIKey | IIBXVCMDEKYDOR-YJYMSZOUSA-N |
| XLogP | 3.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.84 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|