C9H12FN3O2 — CID 15870750
(3aS,4R,5S,7aR)-4-azido-5-fluoro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 15870750) has the molecular formula C9H12FN3O2 and a molecular weight of 213.21 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-4-azido-5-fluoro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,4R,5S,7aR)-4-azido-5-fluoro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 15870750 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (3aS,4R,5S,7aR)-4-azido-5-fluoro-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2[C@@H](N=[N+]=[N-])[C@@H](F)C=C[C@H]2O1 |
| InChI | InChI=1S/C9H12FN3O2/c1-9(2)14-6-4-3-5(10)7(12-13-11)8(6)15-9/h3-8H,1-2H3/t5-,6+,7-,8+/m0/s1 |
| InChIKey | UVIIOXKHVHZJCB-FKSUSPILSA-N |
| XLogP | 2.09 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|