About 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium
2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium (PubChem CID 158707541) has the molecular formula C26H30O5S2
and a molecular weight of 486.66 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium |
| PubChem CID | 158707541 |
| Molecular Formula | C26H30O5S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium |
| SMILES | CCC(C)(C)C(=O)OCCS(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C8H16O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-8(2,3)7(9)13-5-6-14(10,11)12/h1-15H;4-6H2,1-3H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | IIHOTIDDBMECHZ-UHFFFAOYSA-M |
| XLogP | 5.29 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium?
The IUPAC name of 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium (CID 158707541) is 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium.
What is the SMILES notation for 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium?
The canonical SMILES for 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium is CCC(C)(C)C(=O)OCCS(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium?
The InChIKey is IIHOTIDDBMECHZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C8H16O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-8(2,3)7(9)13-5-6-14(10,11)12/h1-15H;4-6H2,1-3H3,(H,10,11,12)/q+1;/p-1.
What are the key properties of 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium?
2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium has a molecular weight of 486.66 g/mol, XLogP of 5.29, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylbutanoyloxy)ethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 158707541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).