C24H31N3O2S2 — CID 158707818
6-(methoxymethyl)-7-methyl-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]octan-2-one (PubChem CID 158707818) has the molecular formula C24H31N3O2S2 and a molecular weight of 457.67 g/mol. Its IUPAC name is 6-(methoxymethyl)-7-methyl-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]octan-2-one.
| Compound Name | 6-(methoxymethyl)-7-methyl-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]octan-2-one |
|---|---|
| PubChem CID | 158707818 |
| Molecular Formula | C24H31N3O2S2 |
| Molecular Weight | 457.67 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 6-(methoxymethyl)-7-methyl-1-[3-([1,3]thiazolo[4,5-c]pyridin-2-yl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]octan-2-one |
| SMILES | COCC(CCCC(=O)Cc1sc2c(c1-c1nc3cnccc3s1)CCNC2)C(C)C |
| InChI | InChI=1S/C24H31N3O2S2/c1-15(2)16(14-29-3)5-4-6-17(28)11-21-23(18-7-9-26-13-22(18)30-21)24-27-19-12-25-10-8-20(19)31-24/h8,10,12,15-16,26H,4-7,9,11,13-14H2,1-3H3 |
| InChIKey | ZJWYVFJHFALPSF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |