About CID 158708509
CID 158708509 (PubChem CID 158708509) has the molecular formula C111H81BBr2N3O5
and a molecular weight of 1707.50 g/mol.
Molecular Properties
| Compound Name | CID 158708509 |
| PubChem CID | 158708509 |
| Molecular Formula | C111H81BBr2N3O5 |
| Molecular Weight | 1707.50 g/mol |
| Exact Mass | 1704.46 |
| IUPAC Name | — |
| SMILES | Brc1cccc(Br)c1.Cc1cc(C)c(-c2ccc3c(c2)c2cc(-c4cccc(-c5ccc6c(c5)c5cc(-c7c(C)cc(C)cc7C)ccc5n6-c5ccc6oc7ccccc7c6c5)c4)ccc2n3-c2ccc3oc4ccccc4c3c2)c(C)c1.Cc1cc(C)c(-c2ccc3c(c2)c2cc(O[B]O)ccc2n3-c2ccc3oc4ccccc4c3c2)c(C)c1 |
| InChI | InChI=1S/C72H52N2O2.C33H25BNO3.C6H4Br2/c1-41-30-43(3)71(44(4)31-41)51-20-26-65-59(37-51)57-35-49(18-24-63(57)73(65)53-22-28-69-61(39-53)55-14-7-9-16-67(55)75-69)47-12-11-13-48(34-47)50-19-25-64-58(36-50)60-38-52(72-45(5)32-42(2)33-46(72)6)21-27-66(60)74(64)54-23-29-70-62(40-54)56-15-8-10-17-68(56)76-70;1-19-14-20(2)33(21(3)15-19)22-8-11-29-26(16-22)27-18-24(38-34-36)10-12-30(27)35(29)23-9-13-32-28(17-23)25-6-4-5-7-31(25)37-32;7-5-2-1-3-6(8)4-5/h7-40H,1-6H3;4-18,36H,1-3H3;1-4H |
| InChIKey | VYKZRYPHEISZMB-UHFFFAOYSA-N |
| XLogP | 31.59 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 122 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1707.50 |
| LogP ≤ 5 | 31.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 158708509 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158708509?
The IUPAC name of CID 158708509 (CID 158708509) is not available.
What is the SMILES notation for CID 158708509?
The canonical SMILES for CID 158708509 is Brc1cccc(Br)c1.Cc1cc(C)c(-c2ccc3c(c2)c2cc(-c4cccc(-c5ccc6c(c5)c5cc(-c7c(C)cc(C)cc7C)ccc5n6-c5ccc6oc7ccccc7c6c5)c4)ccc2n3-c2ccc3oc4ccccc4c3c2)c(C)c1.Cc1cc(C)c(-c2ccc3c(c2)c2cc(O[B]O)ccc2n3-c2ccc3oc4ccccc4c3c2)c(C)c1.
What is the InChIKey of CID 158708509?
The InChIKey is VYKZRYPHEISZMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C72H52N2O2.C33H25BNO3.C6H4Br2/c1-41-30-43(3)71(44(4)31-41)51-20-26-65-59(37-51)57-35-49(18-24-63(57)73(65)53-22-28-69-61(39-53)55-14-7-9-16-67(55)75-69)47-12-11-13-48(34-47)50-19-25-64-58(36-50)60-38-52(72-45(5)32-42(2)33-46(72)6)21-27-66(60)74(64)54-23-29-70-62(40-54)56-15-8-10-17-68(56)76-70;1-19-14-20(2)33(21(3)15-19)22-8-11-29-26(16-22)27-18-24(38-34-36)10-12-30(27)35(29)23-9-13-32-28(17-23)25-6-4-5-7-31(25)37-32;7-5-2-1-3-6(8)4-5/h7-40H,1-6H3;4-18,36H,1-3H3;1-4H.
What are the key properties of CID 158708509?
CID 158708509 has a molecular weight of 1707.50 g/mol, XLogP of 31.59, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158708509 is sourced from PubChem (CID 158708509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).