C19H20ClF2N5O4S — CID 158709656
(2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3,4-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridin-5-yl]-2-methylpropan-2-ol;sulfane (PubChem CID 158709656) has the molecular formula C19H20ClF2N5O4S and a molecular weight of 487.92 g/mol. Its IUPAC name is (2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3,4-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridin-5-yl]-2-methylpropan-2-ol;sulfane.
| Compound Name | (2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3,4-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridin-5-yl]-2-methylpropan-2-ol;sulfane |
|---|---|
| PubChem CID | 158709656 |
| Molecular Formula | C19H20ClF2N5O4S |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (2S)-1-(2-chloro-4-nitroimidazol-1-yl)-3-[2-(3,4-difluorophenyl)-6,7-dihydro-4H-[1,3]oxazolo[5,4-c]pyridin-5-yl]-2-methylpropan-2-ol;sulfane |
| SMILES | C[C@](O)(CN1CCc2nc(-c3ccc(F)c(F)c3)oc2C1)Cn1cc([N+](=O)[O-])nc1Cl.S |
| InChI | InChI=1S/C19H18ClF2N5O4.H2S/c1-19(28,10-26-8-16(27(29)30)24-18(26)20)9-25-5-4-14-15(7-25)31-17(23-14)11-2-3-12(21)13(22)6-11;/h2-3,6,8,28H,4-5,7,9-10H2,1H3;1H2/t19-;/m0./s1 |
| InChIKey | IIOFOEZPSUIVLI-FYZYNONXSA-N |
| XLogP | 3.30 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|