C44H58N6O4 — CID 158710609
1-(6-methoxy-3-pyridinyl)-3-[4-(4-methylpyrimidin-2-yl)cyclohexyl]pentan-1-one (PubChem CID 158710609) has the molecular formula C44H58N6O4 and a molecular weight of 734.99 g/mol. Its IUPAC name is 1-(6-methoxy-3-pyridinyl)-3-[4-(4-methylpyrimidin-2-yl)cyclohexyl]pentan-1-one.
| Compound Name | 1-(6-methoxy-3-pyridinyl)-3-[4-(4-methylpyrimidin-2-yl)cyclohexyl]pentan-1-one |
|---|---|
| PubChem CID | 158710609 |
| Molecular Formula | C44H58N6O4 |
| Molecular Weight | 734.99 g/mol |
| Exact Mass | 734.45 |
| IUPAC Name | 1-(6-methoxy-3-pyridinyl)-3-[4-(4-methylpyrimidin-2-yl)cyclohexyl]pentan-1-one |
| SMILES | CCC(CC(=O)c1ccc(OC)nc1)C1CCC(c2nccc(C)n2)CC1.CCC(CC(=O)c1ccc(OC)nc1)C1CCC(c2nccc(C)n2)CC1 |
| InChI | InChI=1S/2C22H29N3O2/c2*1-4-16(13-20(26)19-9-10-21(27-3)24-14-19)17-5-7-18(8-6-17)22-23-12-11-15(2)25-22/h2*9-12,14,16-18H,4-8,13H2,1-3H3 |
| InChIKey | IIQZXVUXEFITEH-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 129.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.99 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |