C23H26ClN3O2 — CID 158710613
3-[1-[4-(3-chloro-5-methylphenyl)-4-oxobutyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 158710613) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 3-[1-[4-(3-chloro-5-methylphenyl)-4-oxobutyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[4-(3-chloro-5-methylphenyl)-4-oxobutyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 158710613 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 3-[1-[4-(3-chloro-5-methylphenyl)-4-oxobutyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | Cc1cc(Cl)cc(C(=O)CCCN2CCC(n3c(=O)[nH]c4ccccc43)CC2)c1 |
| InChI | InChI=1S/C23H26ClN3O2/c1-16-13-17(15-18(24)14-16)22(28)7-4-10-26-11-8-19(9-12-26)27-21-6-3-2-5-20(21)25-23(27)29/h2-3,5-6,13-15,19H,4,7-12H2,1H3,(H,25,29) |
| InChIKey | CPVDBWHUJIRRCN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |