C32H41F5O5S — CID 15871080
(1S,3aS,5R,6S,7aS)-5-(4-hydroxyphenyl)-7a-methyl-6-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-ol (PubChem CID 15871080) has the molecular formula C32H41F5O5S and a molecular weight of 632.73 g/mol. Its IUPAC name is (1S,3aS,5R,6S,7aS)-5-(4-hydroxyphenyl)-7a-methyl-6-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-ol.
| Compound Name | (1S,3aS,5R,6S,7aS)-5-(4-hydroxyphenyl)-7a-methyl-6-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
|---|---|
| PubChem CID | 15871080 |
| Molecular Formula | C32H41F5O5S |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | (1S,3aS,5R,6S,7aS)-5-(4-hydroxyphenyl)-7a-methyl-6-[4-[5-(4,4,5,5,5-pentafluoropentylsulfonyl)pentoxy]phenyl]-1,2,3,3a,4,5,6,7-octahydroinden-1-ol |
| SMILES | C[C@]12C[C@H](c3ccc(OCCCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F)cc3)[C@H](c3ccc(O)cc3)C[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C32H41F5O5S/c1-30-21-28(27(20-24(30)10-15-29(30)39)22-6-11-25(38)12-7-22)23-8-13-26(14-9-23)42-17-3-2-4-18-43(40,41)19-5-16-31(33,34)32(35,36)37/h6-9,11-14,24,27-29,38-39H,2-5,10,15-21H2,1H3/t24-,27-,28+,29-,30-/m0/s1 |
| InChIKey | KLDQJRCZKNOZIB-HTJGQTEWSA-N |
| XLogP | 7.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|