C22H28BrFO3 — CID 15871219
(6S,8S,10R,13S,14S,16R,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 15871219) has the molecular formula C22H28BrFO3 and a molecular weight of 439.37 g/mol. Its IUPAC name is (6S,8S,10R,13S,14S,16R,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (6S,8S,10R,13S,14S,16R,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 15871219 |
| Molecular Formula | C22H28BrFO3 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (6S,8S,10R,13S,14S,16R,17R)-17-(2-bromoacetyl)-6-fluoro-17-hydroxy-10,13,16-trimethyl-2,6,7,8,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)CC[C@]4(C)C3=CC[C@]2(C)[C@@]1(O)C(=O)CBr |
| InChI | InChI=1S/C22H28BrFO3/c1-12-8-16-14-10-18(24)17-9-13(25)4-6-20(17,2)15(14)5-7-21(16,3)22(12,27)19(26)11-23/h5,9,12,14,16,18,27H,4,6-8,10-11H2,1-3H3/t12-,14-,16+,18+,20-,21+,22+/m1/s1 |
| InChIKey | UGVNGCMUUNIHRF-XUOSUNSOSA-N |
| XLogP | 4.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|