About methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate
methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate (PubChem CID 158714477) has the molecular formula C18H20Br2N2O4
and a molecular weight of 488.18 g/mol. Its IUPAC name is methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate |
| PubChem CID | 158714477 |
| Molecular Formula | C18H20Br2N2O4 |
| Molecular Weight | 488.18 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate |
| SMILES | COC(=O)c1ccc(N(C)C)c(Br)c1.COC(=O)c1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C10H12BrNO2.C8H8BrNO2/c1-12(2)9-5-4-7(6-8(9)11)10(13)14-3;1-12-8(11)5-2-3-7(10)6(9)4-5/h4-6H,1-3H3;2-4H,10H2,1H3 |
| InChIKey | IJDHXXJMQLTFMM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.18 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate?
The IUPAC name of methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate (CID 158714477) is methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate.
What is the SMILES notation for methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate?
The canonical SMILES for methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate is COC(=O)c1ccc(N(C)C)c(Br)c1.COC(=O)c1ccc(N)c(Br)c1.
What is the InChIKey of methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate?
The InChIKey is IJDHXXJMQLTFMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2.C8H8BrNO2/c1-12(2)9-5-4-7(6-8(9)11)10(13)14-3;1-12-8(11)5-2-3-7(10)6(9)4-5/h4-6H,1-3H3;2-4H,10H2,1H3.
What are the key properties of methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate?
methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate has a molecular weight of 488.18 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3-bromobenzoate;methyl 3-bromo-4-(dimethylamino)benzoate is sourced from PubChem (CID 158714477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).