C42H39N3Si — CID 158714839
[3-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenyl]-(3-isoquinolin-1-ylphenyl)-phenylsilane (PubChem CID 158714839) has the molecular formula C42H39N3Si and a molecular weight of 613.88 g/mol. Its IUPAC name is [3-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenyl]-(3-isoquinolin-1-ylphenyl)-phenylsilane.
| Compound Name | [3-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenyl]-(3-isoquinolin-1-ylphenyl)-phenylsilane |
|---|---|
| PubChem CID | 158714839 |
| Molecular Formula | C42H39N3Si |
| Molecular Weight | 613.88 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | [3-[1-[2,6-di(propan-2-yl)phenyl]imidazol-2-yl]phenyl]-(3-isoquinolin-1-ylphenyl)-phenylsilane |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1cccc([SiH](c2ccccc2)c2cccc(-c3nccc4ccccc34)c2)c1 |
| InChI | InChI=1S/C42H39N3Si/c1-29(2)37-21-12-22-38(30(3)4)41(37)45-26-25-44-42(45)33-15-11-19-36(28-33)46(34-16-6-5-7-17-34)35-18-10-14-32(27-35)40-39-20-9-8-13-31(39)23-24-43-40/h5-30,46H,1-4H3 |
| InChIKey | FEKBGHPAMDGHGS-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.88 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|