C36H47F2O6S2+ — CID 158715020
(4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-methyl-4,6-di(propan-2-yl)-1,3-dioxan-2-yl]phenyl]sulfanium (PubChem CID 158715020) has the molecular formula C36H47F2O6S2+ and a molecular weight of 677.90 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-methyl-4,6-di(propan-2-yl)-1,3-dioxan-2-yl]phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-methyl-4,6-di(propan-2-yl)-1,3-dioxan-2-yl]phenyl]sulfanium |
|---|---|
| PubChem CID | 158715020 |
| Molecular Formula | C36H47F2O6S2+ |
| Molecular Weight | 677.90 g/mol |
| Exact Mass | 677.28 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(1,1-difluoro-1-sulfopropan-2-yl)oxyphenyl]-[4-[2-methyl-4,6-di(propan-2-yl)-1,3-dioxan-2-yl]phenyl]sulfanium |
| SMILES | CC(C)C1CC(C(C)C)OC(C)(c2ccc([S+](c3ccc(OC(C)C(F)(F)S(=O)(=O)O)cc3)c3ccc(C(C)(C)C)cc3)cc2)O1 |
| InChI | InChI=1S/C36H46F2O6S2/c1-23(2)32-22-33(24(3)4)44-35(9,43-32)27-12-18-30(19-13-27)45(29-16-10-26(11-17-29)34(6,7)8)31-20-14-28(15-21-31)42-25(5)36(37,38)46(39,40)41/h10-21,23-25,32-33H,22H2,1-9H3/p+1 |
| InChIKey | YUNBFKHGJSEUOA-UHFFFAOYSA-O |
| XLogP | 8.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.90 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|