C30H38FN3O4 — CID 158715114
4-(5-fluoro-2-methoxyphenyl)-2-[1-(oxan-3-ylmethyl)pyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridine;oxane-3-carbaldehyde (PubChem CID 158715114) has the molecular formula C30H38FN3O4 and a molecular weight of 523.65 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxyphenyl)-2-[1-(oxan-3-ylmethyl)pyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridine;oxane-3-carbaldehyde.
| Compound Name | 4-(5-fluoro-2-methoxyphenyl)-2-[1-(oxan-3-ylmethyl)pyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridine;oxane-3-carbaldehyde |
|---|---|
| PubChem CID | 158715114 |
| Molecular Formula | C30H38FN3O4 |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 4-(5-fluoro-2-methoxyphenyl)-2-[1-(oxan-3-ylmethyl)pyrrolidin-3-yl]-1H-pyrrolo[2,3-b]pyridine;oxane-3-carbaldehyde |
| SMILES | COc1ccc(F)cc1-c1ccnc2[nH]c(C3CCN(CC4CCCOC4)C3)cc12.O=CC1CCCOC1 |
| InChI | InChI=1S/C24H28FN3O2.C6H10O2/c1-29-23-5-4-18(25)11-20(23)19-6-8-26-24-21(19)12-22(27-24)17-7-9-28(14-17)13-16-3-2-10-30-15-16;7-4-6-2-1-3-8-5-6/h4-6,8,11-12,16-17H,2-3,7,9-10,13-15H2,1H3,(H,26,27);4,6H,1-3,5H2 |
| InChIKey | IJFGDPQXDZDOGR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|