C38H40BClN2O2 — CID 158715608
(4-butan-2-ylphenyl)boronic acid;1-(4-butan-2-ylphenyl)isoquinoline;1-chloroisoquinoline (PubChem CID 158715608) has the molecular formula C38H40BClN2O2 and a molecular weight of 603.02 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)boronic acid;1-(4-butan-2-ylphenyl)isoquinoline;1-chloroisoquinoline.
| Compound Name | (4-butan-2-ylphenyl)boronic acid;1-(4-butan-2-ylphenyl)isoquinoline;1-chloroisoquinoline |
|---|---|
| PubChem CID | 158715608 |
| Molecular Formula | C38H40BClN2O2 |
| Molecular Weight | 603.02 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | (4-butan-2-ylphenyl)boronic acid;1-(4-butan-2-ylphenyl)isoquinoline;1-chloroisoquinoline |
| SMILES | CCC(C)c1ccc(-c2nccc3ccccc23)cc1.CCC(C)c1ccc(B(O)O)cc1.Clc1nccc2ccccc12 |
| InChI | InChI=1S/C19H19N.C10H15BO2.C9H6ClN/c1-3-14(2)15-8-10-17(11-9-15)19-18-7-5-4-6-16(18)12-13-20-19;1-3-8(2)9-4-6-10(7-5-9)11(12)13;10-9-8-4-2-1-3-7(8)5-6-11-9/h4-14H,3H2,1-2H3;4-8,12-13H,3H2,1-2H3;1-6H |
| InChIKey | IJGQCHGYCZXUSY-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.02 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|