C26H50O6Si — CID 158715733
tert-butyl-dimethyl-[(Z,4S)-4-(oxan-2-yloxy)pent-2-enoxy]silane;(Z,4S)-4-(oxan-2-yloxy)pent-2-en-1-ol (PubChem CID 158715733) has the molecular formula C26H50O6Si and a molecular weight of 486.77 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,4S)-4-(oxan-2-yloxy)pent-2-enoxy]silane;(Z,4S)-4-(oxan-2-yloxy)pent-2-en-1-ol.
| Compound Name | tert-butyl-dimethyl-[(Z,4S)-4-(oxan-2-yloxy)pent-2-enoxy]silane;(Z,4S)-4-(oxan-2-yloxy)pent-2-en-1-ol |
|---|---|
| PubChem CID | 158715733 |
| Molecular Formula | C26H50O6Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,4S)-4-(oxan-2-yloxy)pent-2-enoxy]silane;(Z,4S)-4-(oxan-2-yloxy)pent-2-en-1-ol |
| SMILES | C[C@@H](/C=C\CO)OC1CCCCO1.C[C@@H](/C=C\CO[Si](C)(C)C(C)(C)C)OC1CCCCO1 |
| InChI | InChI=1S/C16H32O3Si.C10H18O3/c1-14(19-15-11-7-8-12-17-15)10-9-13-18-20(5,6)16(2,3)4;1-9(5-4-7-11)13-10-6-2-3-8-12-10/h9-10,14-15H,7-8,11-13H2,1-6H3;4-5,9-11H,2-3,6-8H2,1H3/b10-9-;5-4-/t14-,15?;9-,10?/m00/s1 |
| InChIKey | IJHAKKHJHNAZSY-HTGWXGSWSA-N |
| XLogP | 5.96 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|