C13H26N4O — CID 158716177
4,4-dimethylpentan-2-one;5-(2,2-dimethylpropyl)-2H-tetrazole (PubChem CID 158716177) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is 4,4-dimethylpentan-2-one;5-(2,2-dimethylpropyl)-2H-tetrazole.
| Compound Name | 4,4-dimethylpentan-2-one;5-(2,2-dimethylpropyl)-2H-tetrazole |
|---|---|
| PubChem CID | 158716177 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 4,4-dimethylpentan-2-one;5-(2,2-dimethylpropyl)-2H-tetrazole |
| SMILES | CC(=O)CC(C)(C)C.CC(C)(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C7H14O.C6H12N4/c1-6(8)5-7(2,3)4;1-6(2,3)4-5-7-9-10-8-5/h5H2,1-4H3;4H2,1-3H3,(H,7,8,9,10) |
| InChIKey | IJIJZNMHYHUWMV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |