About 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide
4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide (PubChem CID 15871722) has the molecular formula C21H23N3O
and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide.
Molecular Properties
| Compound Name | 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide |
| PubChem CID | 15871722 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide |
| SMILES | CCc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O/c1-2-19-23-14-16-24(19)15-13-21(20(22)25,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,14,16H,2,13,15H2,1H3,(H2,22,25) |
| InChIKey | KJIUYOWIHUZEIV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide?
The IUPAC name of 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide (CID 15871722) is 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide.
What is the SMILES notation for 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide?
The canonical SMILES for 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide is CCc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide?
The InChIKey is KJIUYOWIHUZEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O/c1-2-19-23-14-16-24(19)15-13-21(20(22)25,17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,14,16H,2,13,15H2,1H3,(H2,22,25).
What are the key properties of 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide?
4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide has a molecular weight of 333.44 g/mol, XLogP of 3.31, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-ethylimidazol-1-yl)-2,2-diphenylbutanamide is sourced from PubChem (CID 15871722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).